C16H15N3OS — CID 61289852
5-amino-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-methylbenzamide (PubChem CID 61289852) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-amino-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-methylbenzamide.
| Compound Name | 5-amino-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 61289852 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-amino-N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1sc2c(c1C#N)CCC2 |
| InChI | InChI=1S/C16H15N3OS/c1-9-5-6-10(18)7-12(9)15(20)19-16-13(8-17)11-3-2-4-14(11)21-16/h5-7H,2-4,18H2,1H3,(H,19,20) |
| InChIKey | MUSATCYQHUZKSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|