C13H17N3OS — CID 61295934
1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine (PubChem CID 61295934) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine.
| Compound Name | 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 61295934 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine |
| SMILES | NC1CCCN(Cc2coc(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C13H17N3OS/c14-10-3-1-5-16(7-10)8-11-9-17-13(15-11)12-4-2-6-18-12/h2,4,6,9-10H,1,3,5,7-8,14H2 |
| InChIKey | HWUXHVGGQHXGKC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |