C16H21N3OS — CID 95768126
4-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-thiophen-2-yl-1,3-oxazole (PubChem CID 95768126) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 95768126 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-2-thiophen-2-yl-1,3-oxazole |
| SMILES | C[C@@H]1CN2CCC[C@@H]2CN1Cc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H21N3OS/c1-12-8-18-6-2-4-14(18)10-19(12)9-13-11-20-16(17-13)15-5-3-7-21-15/h3,5,7,11-12,14H,2,4,6,8-10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | APCPMVDYDWJSDV-TZMCWYRMSA-N |
| XLogP | 3.07 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |