C15H16N2O — CID 61296197
N-(3-aminophenyl)-N,4-dimethylbenzamide (PubChem CID 61296197) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(3-aminophenyl)-N,4-dimethylbenzamide.
| Compound Name | N-(3-aminophenyl)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 61296197 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-(3-aminophenyl)-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C15H16N2O/c1-11-6-8-12(9-7-11)15(18)17(2)14-5-3-4-13(16)10-14/h3-10H,16H2,1-2H3 |
| InChIKey | GTZYDUSGYHTMDS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|