C14H11F3N2O2 — CID 61297683
N-(3-aminophenyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide (PubChem CID 61297683) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is N-(3-aminophenyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide.
| Compound Name | N-(3-aminophenyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 61297683 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(3-aminophenyl)-2,4,5-trifluoro-3-hydroxy-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(F)c(F)c(O)c1F)c1cccc(N)c1 |
| InChI | InChI=1S/C14H11F3N2O2/c1-19(8-4-2-3-7(18)5-8)14(21)9-6-10(15)12(17)13(20)11(9)16/h2-6,20H,18H2,1H3 |
| InChIKey | LPFPISDZIWRNJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|