C16H11BrFNO — CID 61299084
N-[(5-bromo-2-fluorophenyl)methyl]-3-phenylprop-2-ynamide (PubChem CID 61299084) has the molecular formula C16H11BrFNO and a molecular weight of 332.17 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-phenylprop-2-ynamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 61299084 |
| Molecular Formula | C16H11BrFNO |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-phenylprop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C16H11BrFNO/c17-14-7-8-15(18)13(10-14)11-19-16(20)9-6-12-4-2-1-3-5-12/h1-5,7-8,10H,11H2,(H,19,20) |
| InChIKey | WRAWVEDYZKXBJR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|