C11H13BrFNO4S — CID 61299271
4-[(5-bromo-2-fluorophenyl)methylsulfamoyl]butanoic acid (PubChem CID 61299271) has the molecular formula C11H13BrFNO4S and a molecular weight of 354.20 g/mol. Its IUPAC name is 4-[(5-bromo-2-fluorophenyl)methylsulfamoyl]butanoic acid.
| Compound Name | 4-[(5-bromo-2-fluorophenyl)methylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 61299271 |
| Molecular Formula | C11H13BrFNO4S |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 4-[(5-bromo-2-fluorophenyl)methylsulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H13BrFNO4S/c12-9-3-4-10(13)8(6-9)7-14-19(17,18)5-1-2-11(15)16/h3-4,6,14H,1-2,5,7H2,(H,15,16) |
| InChIKey | NZFPBNFNGJOTLK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |