C13H10N2O5S — CID 61300668
2-[2-(furan-2-carbonylamino)-2-oxoethyl]sulfanylpyridine-4-carboxylic acid (PubChem CID 61300668) has the molecular formula C13H10N2O5S and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-[2-(furan-2-carbonylamino)-2-oxoethyl]sulfanylpyridine-4-carboxylic acid.
| Compound Name | 2-[2-(furan-2-carbonylamino)-2-oxoethyl]sulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 61300668 |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[2-(furan-2-carbonylamino)-2-oxoethyl]sulfanylpyridine-4-carboxylic acid |
| SMILES | O=C(CSc1cc(C(=O)O)ccn1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H10N2O5S/c16-10(15-12(17)9-2-1-5-20-9)7-21-11-6-8(13(18)19)3-4-14-11/h1-6H,7H2,(H,18,19)(H,15,16,17) |
| InChIKey | NWMSFACNLTZDAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |