C11H12N2O2S — CID 61301256
2-(4-cyanobutylsulfanyl)pyridine-4-carboxylic acid (PubChem CID 61301256) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(4-cyanobutylsulfanyl)pyridine-4-carboxylic acid.
| Compound Name | 2-(4-cyanobutylsulfanyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 61301256 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-(4-cyanobutylsulfanyl)pyridine-4-carboxylic acid |
| SMILES | N#CCCCCSc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C11H12N2O2S/c12-5-2-1-3-7-16-10-8-9(11(14)15)4-6-13-10/h4,6,8H,1-3,7H2,(H,14,15) |
| InChIKey | LRUPGVZDAYEBER-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|