C9H8ClNO2S — CID 82238192
2-[(E)-3-chloroprop-2-enyl]sulfanylpyridine-4-carboxylic acid (PubChem CID 82238192) has the molecular formula C9H8ClNO2S and a molecular weight of 229.69 g/mol. Its IUPAC name is 2-[(E)-3-chloroprop-2-enyl]sulfanylpyridine-4-carboxylic acid.
| Compound Name | 2-[(E)-3-chloroprop-2-enyl]sulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 82238192 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 2-[(E)-3-chloroprop-2-enyl]sulfanylpyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(SC/C=C/Cl)c1 |
| InChI | InChI=1S/C9H8ClNO2S/c10-3-1-5-14-8-6-7(9(12)13)2-4-11-8/h1-4,6H,5H2,(H,12,13)/b3-1+ |
| InChIKey | OESMHMWCTAAMAK-HNQUOIGGSA-N |
| XLogP | 2.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |