C16H22N2O — CID 61309173
4-(2-bicyclo[2.2.1]heptanylamino)-N,3-dimethylbenzamide (PubChem CID 61309173) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylamino)-N,3-dimethylbenzamide.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylamino)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 61309173 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylamino)-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(NC2CC3CCC2C3)c(C)c1 |
| InChI | InChI=1S/C16H22N2O/c1-10-7-13(16(19)17-2)5-6-14(10)18-15-9-11-3-4-12(15)8-11/h5-7,11-12,15,18H,3-4,8-9H2,1-2H3,(H,17,19) |
| InChIKey | VWNIUZKIHZMAIA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |