C16H21N3O2 — CID 61311892
ethyl 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 61311892) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | ethyl 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 61311892 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(N)ccc1-n1nc(C)c(CC)c1C |
| InChI | InChI=1S/C16H21N3O2/c1-5-13-10(3)18-19(11(13)4)15-8-7-12(17)9-14(15)16(20)21-6-2/h7-9H,5-6,17H2,1-4H3 |
| InChIKey | JQEFATMNZCHYES-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|