C14H20N4O2S — CID 103287594
5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-methylbenzenesulfonamide (PubChem CID 103287594) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103287594 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-amino-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-methylbenzenesulfonamide |
| SMILES | CCc1c(C)nn(-c2ccc(N)cc2S(=O)(=O)NC)c1C |
| InChI | InChI=1S/C14H20N4O2S/c1-5-12-9(2)17-18(10(12)3)13-7-6-11(15)8-14(13)21(19,20)16-4/h6-8,16H,5,15H2,1-4H3 |
| InChIKey | KYJAUOKAARHREY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|