C12H10F5N3 — CID 61314637
N-methyl-1-(1-methylimidazol-2-yl)-1-(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 61314637) has the molecular formula C12H10F5N3 and a molecular weight of 291.22 g/mol. Its IUPAC name is N-methyl-1-(1-methylimidazol-2-yl)-1-(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | N-methyl-1-(1-methylimidazol-2-yl)-1-(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 61314637 |
| Molecular Formula | C12H10F5N3 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-methyl-1-(1-methylimidazol-2-yl)-1-(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | CNC(c1c(F)c(F)c(F)c(F)c1F)c1nccn1C |
| InChI | InChI=1S/C12H10F5N3/c1-18-11(12-19-3-4-20(12)2)5-6(13)8(15)10(17)9(16)7(5)14/h3-4,11,18H,1-2H3 |
| InChIKey | VVAZNFVUGGTFNJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|