C12H13FIN3 — CID 114029545
1-(4-fluoro-2-iodophenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine (PubChem CID 114029545) has the molecular formula C12H13FIN3 and a molecular weight of 345.16 g/mol. Its IUPAC name is 1-(4-fluoro-2-iodophenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine.
| Compound Name | 1-(4-fluoro-2-iodophenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 114029545 |
| Molecular Formula | C12H13FIN3 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 1-(4-fluoro-2-iodophenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine |
| SMILES | CNC(c1ccc(F)cc1I)c1nccn1C |
| InChI | InChI=1S/C12H13FIN3/c1-15-11(12-16-5-6-17(12)2)9-4-3-8(13)7-10(9)14/h3-7,11,15H,1-2H3 |
| InChIKey | QKNAOOMYBGOBNE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|