C13H16BrN3O — CID 113296174
1-(4-bromo-2-methoxyphenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine (PubChem CID 113296174) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxyphenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine.
| Compound Name | 1-(4-bromo-2-methoxyphenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 113296174 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-(4-bromo-2-methoxyphenyl)-N-methyl-1-(1-methylimidazol-2-yl)methanamine |
| SMILES | CNC(c1ccc(Br)cc1OC)c1nccn1C |
| InChI | InChI=1S/C13H16BrN3O/c1-15-12(13-16-6-7-17(13)2)10-5-4-9(14)8-11(10)18-3/h4-8,12,15H,1-3H3 |
| InChIKey | DIZVYIYTYSQREP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |