C19H20BrN3O — CID 92854374
(1R)-N-[(5-bromo-2-methoxyphenyl)methyl]-1-(1-methylimidazol-2-yl)-1-phenylmethanamine (PubChem CID 92854374) has the molecular formula C19H20BrN3O and a molecular weight of 386.29 g/mol. Its IUPAC name is (1R)-N-[(5-bromo-2-methoxyphenyl)methyl]-1-(1-methylimidazol-2-yl)-1-phenylmethanamine.
| Compound Name | (1R)-N-[(5-bromo-2-methoxyphenyl)methyl]-1-(1-methylimidazol-2-yl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 92854374 |
| Molecular Formula | C19H20BrN3O |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (1R)-N-[(5-bromo-2-methoxyphenyl)methyl]-1-(1-methylimidazol-2-yl)-1-phenylmethanamine |
| SMILES | COc1ccc(Br)cc1CN[C@H](c1ccccc1)c1nccn1C |
| InChI | InChI=1S/C19H20BrN3O/c1-23-11-10-21-19(23)18(14-6-4-3-5-7-14)22-13-15-12-16(20)8-9-17(15)24-2/h3-12,18,22H,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | KXGLNGMYVUDAJU-GOSISDBHSA-N |
| XLogP | 4.07 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |