C20H22N4O2 — CID 38202343
1-[(2-methoxyphenyl)methyl]-3-[(S)-(1-methylimidazol-2-yl)-phenylmethyl]urea (PubChem CID 38202343) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-3-[(S)-(1-methylimidazol-2-yl)-phenylmethyl]urea.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-3-[(S)-(1-methylimidazol-2-yl)-phenylmethyl]urea |
|---|---|
| PubChem CID | 38202343 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-3-[(S)-(1-methylimidazol-2-yl)-phenylmethyl]urea |
| SMILES | COc1ccccc1CNC(=O)N[C@@H](c1ccccc1)c1nccn1C |
| InChI | InChI=1S/C20H22N4O2/c1-24-13-12-21-19(24)18(15-8-4-3-5-9-15)23-20(25)22-14-16-10-6-7-11-17(16)26-2/h3-13,18H,14H2,1-2H3,(H2,22,23,25)/t18-/m0/s1 |
| InChIKey | QVUUCULVKBLDER-SFHVURJKSA-N |
| XLogP | 3.02 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |