C24H31N5O2 — CID 78886445
1-(2-anilino-3-methylbutyl)-3-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 78886445) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-(2-anilino-3-methylbutyl)-3-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-(2-anilino-3-methylbutyl)-3-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 78886445 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-(2-anilino-3-methylbutyl)-3-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | COc1ccc(C(NC(=O)NCC(Nc2ccccc2)C(C)C)c2nccn2C)cc1 |
| InChI | InChI=1S/C24H31N5O2/c1-17(2)21(27-19-8-6-5-7-9-19)16-26-24(30)28-22(23-25-14-15-29(23)3)18-10-12-20(31-4)13-11-18/h5-15,17,21-22,27H,16H2,1-4H3,(H2,26,28,30) |
| InChIKey | NLZWZKNRUBLQBE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |