C11H10Cl2N4O2 — CID 61315883
(2,6-dichlorophenyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61315883) has the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
|---|---|
| PubChem CID | 61315883 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | Nc1ncn(CC(=O)OCc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N4O2/c12-8-2-1-3-9(13)7(8)5-19-10(18)4-17-6-15-11(14)16-17/h1-3,6H,4-5H2,(H2,14,16) |
| InChIKey | AEKBLWQRQNLXNN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |