C15H15F2NO3 — CID 61318661
3-[[[4-(difluoromethoxy)phenyl]methylamino]methyl]benzene-1,2-diol (PubChem CID 61318661) has the molecular formula C15H15F2NO3 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[[[4-(difluoromethoxy)phenyl]methylamino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[[4-(difluoromethoxy)phenyl]methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61318661 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[[[4-(difluoromethoxy)phenyl]methylamino]methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNCc2ccc(OC(F)F)cc2)c1O |
| InChI | InChI=1S/C15H15F2NO3/c16-15(17)21-12-6-4-10(5-7-12)8-18-9-11-2-1-3-13(19)14(11)20/h1-7,15,18-20H,8-9H2 |
| InChIKey | PUCNEVFDRNRKDU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|