C16H17NO2 — CID 61319273
3-[(2,3-dihydro-1H-inden-5-ylamino)methyl]benzene-1,2-diol (PubChem CID 61319273) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[(2,3-dihydro-1H-inden-5-ylamino)methyl]benzene-1,2-diol.
| Compound Name | 3-[(2,3-dihydro-1H-inden-5-ylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61319273 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[(2,3-dihydro-1H-inden-5-ylamino)methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNc2ccc3c(c2)CCC3)c1O |
| InChI | InChI=1S/C16H17NO2/c18-15-6-2-5-13(16(15)19)10-17-14-8-7-11-3-1-4-12(11)9-14/h2,5-9,17-19H,1,3-4,10H2 |
| InChIKey | HVDOYESVLYPPMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|