C13H12N4O3 — CID 61320435
6-[3-(1-methylpyrazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid (PubChem CID 61320435) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-[3-(1-methylpyrazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-(1-methylpyrazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61320435 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 6-[3-(1-methylpyrazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid |
| SMILES | Cn1cc(C=CC(=O)Nc2ccc(C(=O)O)cn2)cn1 |
| InChI | InChI=1S/C13H12N4O3/c1-17-8-9(6-15-17)2-5-12(18)16-11-4-3-10(7-14-11)13(19)20/h2-8H,1H3,(H,19,20)(H,14,16,18) |
| InChIKey | YNEVZHIXXHSHAE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|