C18H19N5O — CID 19337452
(E)-N-(1-benzyl-5-methylpyrazol-3-yl)-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 19337452) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-N-(1-benzyl-5-methylpyrazol-3-yl)-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1-benzyl-5-methylpyrazol-3-yl)-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19337452 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (E)-N-(1-benzyl-5-methylpyrazol-3-yl)-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cnn(C)c2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C18H19N5O/c1-14-10-17(21-23(14)13-15-6-4-3-5-7-15)20-18(24)9-8-16-11-19-22(2)12-16/h3-12H,13H2,1-2H3,(H,20,21,24)/b9-8+ |
| InChIKey | GITPNAWYXCEGDV-CMDGGOBGSA-N |
| XLogP | 2.63 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|