C20H20F3N5O — CID 19392875
(E)-3-(1-ethylpyrazol-4-yl)-N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]prop-2-enamide (PubChem CID 19392875) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is (E)-3-(1-ethylpyrazol-4-yl)-N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(1-ethylpyrazol-4-yl)-N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19392875 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (E)-3-(1-ethylpyrazol-4-yl)-N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]prop-2-enamide |
| SMILES | CCn1cc(/C=C/C(=O)Nc2cc(C)n(Cc3cccc(C(F)(F)F)c3)n2)cn1 |
| InChI | InChI=1S/C20H20F3N5O/c1-3-27-12-16(11-24-27)7-8-19(29)25-18-9-14(2)28(26-18)13-15-5-4-6-17(10-15)20(21,22)23/h4-12H,3,13H2,1-2H3,(H,25,26,29)/b8-7+ |
| InChIKey | BCVASTPCZYPVFW-BQYQJAHWSA-N |
| XLogP | 4.13 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|