C17H21F3N4O — CID 19407564
1-butyl-3-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]urea (PubChem CID 19407564) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-butyl-3-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]urea.
| Compound Name | 1-butyl-3-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 19407564 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-butyl-3-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]urea |
| SMILES | CCCCNC(=O)Nc1cc(C)n(Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H21F3N4O/c1-3-4-8-21-16(25)22-15-9-12(2)24(23-15)11-13-6-5-7-14(10-13)17(18,19)20/h5-7,9-10H,3-4,8,11H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | ZNMHOJLTWAEMCL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|