C16H18F3N3O — CID 19392878
N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]butanamide (PubChem CID 19392878) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]butanamide.
| Compound Name | N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 19392878 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1cc(C)n(Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H18F3N3O/c1-3-5-15(23)20-14-8-11(2)22(21-14)10-12-6-4-7-13(9-12)16(17,18)19/h4,6-9H,3,5,10H2,1-2H3,(H,20,21,23) |
| InChIKey | MVRJLROZLJILPB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |