C23H23Cl2N3O — CID 19339410
(E)-N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 19339410) has the molecular formula C23H23Cl2N3O and a molecular weight of 428.36 g/mol. Its IUPAC name is (E)-N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19339410 |
| Molecular Formula | C23H23Cl2N3O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (E)-N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(C(C)C)cc2)nn1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H23Cl2N3O/c1-15(2)18-10-7-17(8-11-18)9-12-23(29)26-22-13-16(3)28(27-22)14-19-20(24)5-4-6-21(19)25/h4-13,15H,14H2,1-3H3,(H,26,27,29)/b12-9+ |
| InChIKey | FSBNRTUEQCUTRZ-FMIVXFBMSA-N |
| XLogP | 6.32 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|