C20H16ClFN4O3 — CID 19335403
(E)-N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 19335403) has the molecular formula C20H16ClFN4O3 and a molecular weight of 414.82 g/mol. Its IUPAC name is (E)-N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19335403 |
| Molecular Formula | C20H16ClFN4O3 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (E)-N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)nn1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H16ClFN4O3/c1-13-10-19(24-25(13)12-16-17(21)6-3-7-18(16)22)23-20(27)9-8-14-4-2-5-15(11-14)26(28)29/h2-11H,12H2,1H3,(H,23,24,27)/b9-8+ |
| InChIKey | FMHDMISWZCXLAT-CMDGGOBGSA-N |
| XLogP | 4.59 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|