C20H16Cl2N4O3 — CID 19337108
(E)-N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 19337108) has the molecular formula C20H16Cl2N4O3 and a molecular weight of 431.28 g/mol. Its IUPAC name is (E)-N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19337108 |
| Molecular Formula | C20H16Cl2N4O3 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (E)-N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O3/c1-13-9-19(24-25(13)12-15-6-7-16(21)11-18(15)22)23-20(27)8-5-14-3-2-4-17(10-14)26(28)29/h2-11H,12H2,1H3,(H,23,24,27)/b8-5+ |
| InChIKey | DHDFYMWDRGYETG-VMPITWQZSA-N |
| XLogP | 5.11 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|