C18H18Cl2N6O3 — CID 19337279
N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-methyl-2-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19337279) has the molecular formula C18H18Cl2N6O3 and a molecular weight of 437.29 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-methyl-2-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-methyl-2-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19337279 |
| Molecular Formula | C18H18Cl2N6O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-methyl-2-(4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)n2cc([N+](=O)[O-])cn2)nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N6O3/c1-11-6-16(23-24(11)9-12-4-5-13(19)7-15(12)20)22-17(27)18(2,3)25-10-14(8-21-25)26(28)29/h4-8,10H,9H2,1-3H3,(H,22,23,27) |
| InChIKey | NHPBTKUGMBZEBP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|