C20H16Cl2N6O3S — CID 19494971
N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19494971) has the molecular formula C20H16Cl2N6O3S and a molecular weight of 491.36 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19494971 |
| Molecular Formula | C20H16Cl2N6O3S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(Cn3cc([N+](=O)[O-])cn3)cs2)nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N6O3S/c1-12-4-19(25-27(12)9-14-2-3-15(21)6-17(14)22)24-20(29)18-5-13(11-32-18)8-26-10-16(7-23-26)28(30)31/h2-7,10-11H,8-9H2,1H3,(H,24,25,29) |
| InChIKey | QQAWZRUPFCHSBC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|