C15H7F5N4O3S — CID 19494908
4-[(4-nitropyrazol-1-yl)methyl]-N-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxamide (PubChem CID 19494908) has the molecular formula C15H7F5N4O3S and a molecular weight of 418.30 g/mol. Its IUPAC name is 4-[(4-nitropyrazol-1-yl)methyl]-N-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxamide.
| Compound Name | 4-[(4-nitropyrazol-1-yl)methyl]-N-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19494908 |
| Molecular Formula | C15H7F5N4O3S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 4-[(4-nitropyrazol-1-yl)methyl]-N-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1cc(Cn2cc([N+](=O)[O-])cn2)cs1 |
| InChI | InChI=1S/C15H7F5N4O3S/c16-9-10(17)12(19)14(13(20)11(9)18)22-15(25)8-1-6(5-28-8)3-23-4-7(2-21-23)24(26)27/h1-2,4-5H,3H2,(H,22,25) |
| InChIKey | NRSCXNRYDIAORQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|