C16H12F2N4O4S — CID 19494949
N-[4-(difluoromethoxy)phenyl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19494949) has the molecular formula C16H12F2N4O4S and a molecular weight of 394.36 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19494949 |
| Molecular Formula | C16H12F2N4O4S |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1cc(Cn2cc([N+](=O)[O-])cn2)cs1 |
| InChI | InChI=1S/C16H12F2N4O4S/c17-16(18)26-13-3-1-11(2-4-13)20-15(23)14-5-10(9-27-14)7-21-8-12(6-19-21)22(24)25/h1-6,8-9,16H,7H2,(H,20,23) |
| InChIKey | VRGPBCFEAFNQTI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|