C21H18Cl2N6O3S — CID 19494890
N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19494890) has the molecular formula C21H18Cl2N6O3S and a molecular weight of 505.39 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19494890 |
| Molecular Formula | C21H18Cl2N6O3S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1NC(=O)c1cc(Cn2cc([N+](=O)[O-])cn2)cs1 |
| InChI | InChI=1S/C21H18Cl2N6O3S/c1-12-20(13(2)28(26-12)10-16-17(22)4-3-5-18(16)23)25-21(30)19-6-14(11-33-19)8-27-9-15(7-24-27)29(31)32/h3-7,9,11H,8,10H2,1-2H3,(H,25,30) |
| InChIKey | OTDOKHLMVAOBGX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|