About (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate
(2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate (PubChem CID 61322453) has the molecular formula C15H13ClN2O3
and a molecular weight of 304.73 g/mol. Its IUPAC name is (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate |
| PubChem CID | 61322453 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate |
| SMILES | NC(=O)c1ccccc1COC(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H13ClN2O3/c16-10-5-6-12(13(17)7-10)15(20)21-8-9-3-1-2-4-11(9)14(18)19/h1-7H,8,17H2,(H2,18,19) |
| InChIKey | AZKBIHOVJGDSIU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate?
The IUPAC name of (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate (CID 61322453) is (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate.
What is the SMILES notation for (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate?
The canonical SMILES for (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate is NC(=O)c1ccccc1COC(=O)c1ccc(Cl)cc1N.
What is the InChIKey of (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate?
The InChIKey is AZKBIHOVJGDSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2O3/c16-10-5-6-12(13(17)7-10)15(20)21-8-9-3-1-2-4-11(9)14(18)19/h1-7H,8,17H2,(H2,18,19).
What are the key properties of (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate?
(2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate has a molecular weight of 304.73 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamoylphenyl)methyl 2-amino-4-chlorobenzoate is sourced from PubChem (CID 61322453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).