C15H18N4O2 — CID 61323673
6-[1-(2-imidazol-1-ylethylamino)ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 61323673) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-[1-(2-imidazol-1-ylethylamino)ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(2-imidazol-1-ylethylamino)ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61323673 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 6-[1-(2-imidazol-1-ylethylamino)ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(NCCn1ccnc1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H18N4O2/c1-11(17-5-7-19-6-4-16-10-19)12-2-3-14-13(8-12)18-15(20)9-21-14/h2-4,6,8,10-11,17H,5,7,9H2,1H3,(H,18,20) |
| InChIKey | JHWOMGUSGLGABF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |