About 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile
2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile (PubChem CID 61324357) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile |
| PubChem CID | 61324357 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile |
| SMILES | CCN(CC)CCNC(C#N)C(C)(C)C |
| InChI | InChI=1S/C12H25N3/c1-6-15(7-2)9-8-14-11(10-13)12(3,4)5/h11,14H,6-9H2,1-5H3 |
| InChIKey | YRBJZELGUAPJBL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile?
The IUPAC name of 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile (CID 61324357) is 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile.
What is the SMILES notation for 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile?
The canonical SMILES for 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile is CCN(CC)CCNC(C#N)C(C)(C)C.
What is the InChIKey of 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile?
The InChIKey is YRBJZELGUAPJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-6-15(7-2)9-8-14-11(10-13)12(3,4)5/h11,14H,6-9H2,1-5H3.
What are the key properties of 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile?
2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile has a molecular weight of 211.35 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethylamino]-3,3-dimethylbutanenitrile is sourced from PubChem (CID 61324357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).