C10H14N4O2 — CID 61326141
3-(2-imidazol-1-ylethylamino)-1-methylpyrrolidine-2,5-dione (PubChem CID 61326141) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-(2-imidazol-1-ylethylamino)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-imidazol-1-ylethylamino)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61326141 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-(2-imidazol-1-ylethylamino)-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(NCCn2ccnc2)C1=O |
| InChI | InChI=1S/C10H14N4O2/c1-13-9(15)6-8(10(13)16)12-3-5-14-4-2-11-7-14/h2,4,7-8,12H,3,5-6H2,1H3 |
| InChIKey | JRUCGAXNHYFUEZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|