C16H17ClN4O2 — CID 98678423
(3R)-1-(4-chlorophenyl)-3-(3-imidazol-1-ylpropylamino)pyrrolidine-2,5-dione (PubChem CID 98678423) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-3-(3-imidazol-1-ylpropylamino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-chlorophenyl)-3-(3-imidazol-1-ylpropylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98678423 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-3-(3-imidazol-1-ylpropylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](NCCCn2ccnc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN4O2/c17-12-2-4-13(5-3-12)21-15(22)10-14(16(21)23)19-6-1-8-20-9-7-18-11-20/h2-5,7,9,11,14,19H,1,6,8,10H2/t14-/m1/s1 |
| InChIKey | WGCRJOWVHYRHSH-CQSZACIVSA-N |
| XLogP | 1.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|