About 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid
2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid (PubChem CID 61328113) has the molecular formula C9H8N2O4S
and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid.
Analyze 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid?
The IUPAC name of 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid (CID 61328113) is 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid.
What is the SMILES notation for 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid?
The canonical SMILES for 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid is O=C(O)COCc1nc2sccc2c(=O)[nH]1.
What is the InChIKey of 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid?
The InChIKey is XZKLVPLZYLRSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4S/c12-7(13)4-15-3-6-10-8(14)5-1-2-16-9(5)11-6/h1-2H,3-4H2,(H,12,13)(H,10,11,14).
What are the key properties of 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid?
2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid has a molecular weight of 240.24 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methoxy]acetic acid is sourced from PubChem (CID 61328113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).