C8H7N3O3S — CID 130510934
2-(thieno[2,3-d]pyrimidin-2-ylamino)oxyacetic acid (PubChem CID 130510934) has the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-(thieno[2,3-d]pyrimidin-2-ylamino)oxyacetic acid.
| Compound Name | 2-(thieno[2,3-d]pyrimidin-2-ylamino)oxyacetic acid |
|---|---|
| PubChem CID | 130510934 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-(thieno[2,3-d]pyrimidin-2-ylamino)oxyacetic acid |
| SMILES | O=C(O)CONc1ncc2ccsc2n1 |
| InChI | InChI=1S/C8H7N3O3S/c12-6(13)4-14-11-8-9-3-5-1-2-15-7(5)10-8/h1-3H,4H2,(H,12,13)(H,9,10,11) |
| InChIKey | MIRYVXHDRDZUJQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|