C10H18N2O5 — CID 61328669
2-[2-oxo-2-(pentan-3-ylcarbamoylamino)ethoxy]acetic acid (PubChem CID 61328669) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[2-oxo-2-(pentan-3-ylcarbamoylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-(pentan-3-ylcarbamoylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 61328669 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[2-oxo-2-(pentan-3-ylcarbamoylamino)ethoxy]acetic acid |
| SMILES | CCC(CC)NC(=O)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-3-7(4-2)11-10(16)12-8(13)5-17-6-9(14)15/h7H,3-6H2,1-2H3,(H,14,15)(H2,11,12,13,16) |
| InChIKey | YKTZJLKFTUQRCP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |