C13H24N2O5 — CID 61470498
2-[2-(6-methylheptan-2-ylcarbamoylamino)-2-oxoethoxy]acetic acid (PubChem CID 61470498) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-[2-(6-methylheptan-2-ylcarbamoylamino)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(6-methylheptan-2-ylcarbamoylamino)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61470498 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[2-(6-methylheptan-2-ylcarbamoylamino)-2-oxoethoxy]acetic acid |
| SMILES | CC(C)CCCC(C)NC(=O)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C13H24N2O5/c1-9(2)5-4-6-10(3)14-13(19)15-11(16)7-20-8-12(17)18/h9-10H,4-8H2,1-3H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | ZCKANFKVTVQYRU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |