C12H11N3O3 — CID 61329379
4-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]morpholine-3,5-dione (PubChem CID 61329379) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 4-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]morpholine-3,5-dione.
| Compound Name | 4-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 61329379 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]morpholine-3,5-dione |
| SMILES | NCC#Cc1cccc(N2C(=O)COCC2=O)n1 |
| InChI | InChI=1S/C12H11N3O3/c13-6-2-4-9-3-1-5-10(14-9)15-11(16)7-18-8-12(15)17/h1,3,5H,6-8,13H2 |
| InChIKey | APJBFEPORMUPPP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|