About methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate
methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate (PubChem CID 61329545) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate.
Analyze methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate?
The IUPAC name of methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate (CID 61329545) is methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate.
What is the SMILES notation for methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate?
The canonical SMILES for methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate is COC(=O)COCC(N)c1c(C)c(C)cc(C)c1C.
What is the InChIKey of methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate?
The InChIKey is SFXXOTLTNGRSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-9-6-10(2)12(4)15(11(9)3)13(16)7-19-8-14(17)18-5/h6,13H,7-8,16H2,1-5H3.
What are the key properties of methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate?
methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate has a molecular weight of 265.35 g/mol, XLogP of 2.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-amino-2-(2,3,5,6-tetramethylphenyl)ethoxy]acetate is sourced from PubChem (CID 61329545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).