About 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine
4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine (PubChem CID 61333414) has the molecular formula C14H24N2S2
and a molecular weight of 284.49 g/mol. Its IUPAC name is 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine.
Molecular Properties
| Compound Name | 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine |
| PubChem CID | 61333414 |
| Molecular Formula | C14H24N2S2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine |
| SMILES | CCCNC1(c2nc(C(C)C)cs2)CCSCC1 |
| InChI | InChI=1S/C14H24N2S2/c1-4-7-15-14(5-8-17-9-6-14)13-16-12(10-18-13)11(2)3/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | LQYWTMVOZCILEE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine?
The IUPAC name of 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine (CID 61333414) is 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine.
What is the SMILES notation for 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine?
The canonical SMILES for 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine is CCCNC1(c2nc(C(C)C)cs2)CCSCC1.
What is the InChIKey of 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine?
The InChIKey is LQYWTMVOZCILEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S2/c1-4-7-15-14(5-8-17-9-6-14)13-16-12(10-18-13)11(2)3/h10-11,15H,4-9H2,1-3H3.
What are the key properties of 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine?
4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine has a molecular weight of 284.49 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propan-2-yl-1,3-thiazol-2-yl)-N-propylthian-4-amine is sourced from PubChem (CID 61333414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).