C17H30N2OS — CID 64751520
N-(2-methoxyethyl)-3,5-dimethyl-1-(4-propan-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 64751520) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,5-dimethyl-1-(4-propan-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3,5-dimethyl-1-(4-propan-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64751520 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-(2-methoxyethyl)-3,5-dimethyl-1-(4-propan-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | COCCNC1(c2nc(C(C)C)cs2)CC(C)CC(C)C1 |
| InChI | InChI=1S/C17H30N2OS/c1-12(2)15-11-21-16(19-15)17(18-6-7-20-5)9-13(3)8-14(4)10-17/h11-14,18H,6-10H2,1-5H3 |
| InChIKey | DUUGHXBHPPYQHX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|