C9H10N4S — CID 61336985
5-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)thiophen-2-amine (PubChem CID 61336985) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)thiophen-2-amine.
| Compound Name | 5-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)thiophen-2-amine |
|---|---|
| PubChem CID | 61336985 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)thiophen-2-amine |
| SMILES | Nc1ccc(-c2n[nH]c(C3CC3)n2)s1 |
| InChI | InChI=1S/C9H10N4S/c10-7-4-3-6(14-7)9-11-8(12-13-9)5-1-2-5/h3-5H,1-2,10H2,(H,11,12,13) |
| InChIKey | LYRIQILCUHQZLP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |