C11H22N4O3 — CID 61338002
2-[2-(aminomethyl)morpholin-4-yl]-N-(ethylcarbamoyl)propanamide (PubChem CID 61338002) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[2-(aminomethyl)morpholin-4-yl]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[2-(aminomethyl)morpholin-4-yl]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 61338002 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[2-(aminomethyl)morpholin-4-yl]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)N1CCOC(CN)C1 |
| InChI | InChI=1S/C11H22N4O3/c1-3-13-11(17)14-10(16)8(2)15-4-5-18-9(6-12)7-15/h8-9H,3-7,12H2,1-2H3,(H2,13,14,16,17) |
| InChIKey | DDNJMQVFBONURL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |